A3305812
                    1-(2,3-Dichlorophenyl)piperazine hydrochloride , 98% , 119532-26-2
                            Synonym(s):
1-(2,3-dichlorophenyl)piperazine;1-(2,3-Dichlorophenyl)piperazine hydrochloride;2,3-DCPP HCl
                            
                        
                CAS NO.:119532-26-2
Empirical Formula: C10H13Cl3N2
Molecular Weight: 267.58
MDL number: MFCD00190238
EINECS: 601-621-5
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB24.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB56.00 | In Stock | 
                                                 | 
                                        
| 100G | RMB139.20 | In Stock | 
                                                 | 
                                        
| 500g | RMB630.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 243-247 °C | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | DMF: 11 mg/ml; DMSO: 16 mg/ml; Ethanol: 5 mg/ml; PBS (pH 7.2): 10 mg/ml | 
                                    
| form | powder to crystal | 
                                    
| color | White to Orange to Green | 
                                    
| Water Solubility | Soluble in water, DMSO and methanol. | 
                                    
| Sensitive | Hygroscopic | 
                                    
| InChI | InChI=1S/C10H12Cl2N2.ClH/c11-8-2-1-3-9(10(8)12)14-6-4-13-5-7-14;/h1-3,13H,4-7H2;1H | 
                                    
| InChIKey | CYQFNNSFAGXCEC-UHFFFAOYSA-N | 
                                    
| SMILES | ClC1C(=CC=CC=1N1CCNCC1)Cl.Cl | 
                                    
| CAS DataBase Reference | 119532-26-2(CAS DataBase Reference) | 
                                    
Description and Uses
Aripiprazole (A771000) intermediate.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 3 | 
| Hazard Note | Irritant | 
| HS Code | 29339900 | 





