A3324912
Decoquinate , ≥97% , 18507-89-6
Synonym(s):
Ethyl 6-decyloxy-7-ethoxy-4-hydroxy-3-quinolinecarboxylate
CAS NO.:18507-89-6
Empirical Formula: C24H35NO5
Molecular Weight: 417.54
MDL number: MFCD00673686
EINECS: 242-389-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB31.20 | In Stock |
|
| 250MG | RMB55.20 | In Stock |
|
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100G | RMB782.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241.0 to 245.0 °C |
| Boiling point: | 517.9±45.0 °C(Predicted) |
| Density | 1.091±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly, Heated, Sonicated) |
| pka | 2.60±0.50(Predicted) |
| form | Solid |
| color | Off-White to Pale Beige |
| Merck | 14,2854 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C24H35NO5/c1-4-7-8-9-10-11-12-13-14-30-21-15-18-20(16-22(21)28-5-2)25-17-19(23(18)26)24(27)29-6-3/h15-17H,4-14H2,1-3H3,(H,25,26) |
| InChIKey | JHAYEQICABJSTP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(OCCCCCCCCCC)=C(OCC)C=2)C(O)=C(C(OCC)=O)C=1 |
| LogP | 8.740 (est) |
| CAS DataBase Reference | 18507-89-6(CAS DataBase Reference) |
| EPA Substance Registry System | Decoquinate (18507-89-6) |
Description and Uses
Decoquinate is a quinolone coccidiostat used in veterinary medicine, in particular as animal feed for poultry.






