A3326512
Dapivirine (TMC120) , ≥98% , 244767-67-7
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB512.80 | In Stock |
|
| 25MG | RMB2014.40 | In Stock |
|
| 100MG | RMB6262.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-222°C |
| Boiling point: | 557.9±60.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.74±0.10(Predicted) |
| form | Solid |
| color | Off-White to Light Beige |
| InChI | 1S/C20H19N5/c1-13-10-14(2)19(15(3)11-13)24-18-8-9-22-20(25-18)23-17-6-4-16(12-21)5-7-17/h4-11H,1-3H3,(H2,22,23,24,25) |
| InChIKey | ILAYIAGXTHKHNT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=NC(=NC=C2)NC3=CC=C(C=C3)C#N)C |
Description and Uses
Non-nucleoside Reverse Transcriptase inhibitor. An antiviral agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
