A3365612
3,5-Dichloro-2,4,6-trifluoropyridine , ≥98.0%(GC) , 1737-93-5
CAS NO.:1737-93-5
Empirical Formula: C5Cl2F3N
Molecular Weight: 201.96
MDL number: MFCD00006226
EINECS: 217-088-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB323.20 | In Stock |
|
| 100G | RMB1174.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 23-24 °C |
| Boiling point: | 159-160 °C(lit.) |
| Density | 1.622 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -4.30±0.10(Predicted) |
| Specific Gravity | 1.622 |
| BRN | 475874 |
| Henry's Law Constant | 1.6×100 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | InChI=1S/C5Cl2F3N/c6-1-3(8)2(7)5(10)11-4(1)9 |
| InChIKey | PKSORSNCSXBXOT-UHFFFAOYSA-N |
| SMILES | C1(F)=NC(F)=C(Cl)C(F)=C1Cl |
| CAS DataBase Reference | 1737-93-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 3,5-dichloro-2,4,6-trifluoro-(1737-93-5) |
| EPA Substance Registry System | Pyridine, 3,5-dichloro-2,4,6-trifluoro- (1737-93-5) |
Description and Uses
3,5-Dichloro-2,4,6-trifluoropyridine serves as a base for agrochemicals[3]. The compound acts as a precursor in Suzuki–Miyaura reactions with arylboronic acids to prepare 3,5-diaryl-2,4,6-trifluoropyridines and 5-aryl-3-chloro-2,4,6-trifluoropyridines, and reacts with sodium methoxide to yield 3,5-dichloro-2-methoxy-4,6-difluoropyridine[1][2]. A 2% formulation of the substance is applied to skin samples[3].
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H310-H318-H400-H410-H315-H319-H330-H335 |
| Precautionary statements | P301+P310a-P304+P340-P320-P330-P405-P501a-P260-P284-P305+P351+P338-P310 |
| Hazard Codes | Xi,T,T+ |
| Risk Statements | 36/37/38-26 |
| Safety Statements | 26-37/39-36-45-36/37-28 |
| RIDADR | UN 3382 6.1/PG 1 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |








