A3367112
1,6-Dibromo-2-naphthol-3-carboxylic Acid , ≥98.0%(GC) , 1779-10-8
CAS NO.：1779-10-8
Empirical Formula: C11H6Br2O3
Molecular Weight: 345.97
MDL number: MFCD00046367
EINECS: 217-214-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB199.20 | In Stock |
|
| 25G | RMB796.80 | In Stock |
|
| 100G | RMB2231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 251-255 °C (lit.) |
| Boiling point: | 427.6±45.0 °C(Predicted) |
| Density | 2.073±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.38±0.30(Predicted) |
| color | Light yellow to Yellow to Green |
| BRN | 2378969 |
| InChI | 1S/C11H6Br2O3/c12-6-1-2-7-5(3-6)4-8(11(15)16)10(14)9(7)13/h1-4,14H,(H,15,16) |
| InChIKey | WNMKUIQCIRAXBN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc2cc(Br)ccc2c(Br)c1O |
| CAS DataBase Reference | 1779-10-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 4,7-dibromo-3-hydroxy- (1779-10-8) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
