A3367812
2,5-dichloro-3-nitropyridine , 97% , 21427-62-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB68.80 | In Stock |
|
| 25G | RMB244.80 | In Stock |
|
| 100G | RMB712.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-45 °C |
| Boiling point: | 265.3±35.0 °C(Predicted) |
| Density | 1.629±0.06 g/cm3(Predicted) |
| Flash point: | >110°(230°F) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder and/or Chunks |
| pka | -4.99±0.10(Predicted) |
| color | Light beige-green to orange |
| InChI | 1S/C5H2Cl2N2O2/c6-3-1-4(9(10)11)5(7)8-2-3/h1-2H |
| InChIKey | OBUGJYJQJWMOQO-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(Cl)cnc1Cl |
| CAS DataBase Reference | 21427-62-3(CAS DataBase Reference) |
Description and Uses
2,5-Dichloro-3-Nitropyridine has useful herbicidal properties. Furthermore, it is useful as a chemical intermediate for dyes, pharmaceutical and other agricultural applications.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 36/37/38-22-43-41-37/38-25 |
| Safety Statements | 36/37/39-26-45 |
| RIDADR | 2811 |
| WGK Germany | 1 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








