A3368712
Dipropyleneglycolmonobutylether , ≥98%, the heterogeneous mixture , 29911-28-2
CAS NO.:29911-28-2
Empirical Formula: C10H22O3
Molecular Weight: 190.28
MDL number: MFCD00192112
EINECS: 249-951-5
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB26.40 | In Stock |
|
| 500ml | RMB102.40 | In Stock |
|
| 1L | RMB193.60 | In Stock |
|
| 5L | RMB764.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 222-232 °C(lit.) |
| Density | 0.913 g/mL at 25 °C(lit.) |
| vapor pressure | 4Pa at 20℃ |
| refractive index | n |
| Flash point: | 205 °F |
| storage temp. | Store at room temperature, keep dry and cool |
| form | liquid |
| pka | 14.41±0.20(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | 40g/L at 25℃ |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C10H22O3/c1-4-5-6-12-8-10(3)13-7-9(2)11/h9-11H,4-8H2,1-3H3 |
| InChIKey | CUVLMZNMSPJDON-UHFFFAOYSA-N |
| SMILES | C(OC(C)COCCCC)C(O)C |
| LogP | 1.52 at 20℃ |
| CAS DataBase Reference | 29911-28-2 |
| EPA Substance Registry System | 1-(2-Butoxy-1-methylethoxy)-2-propanol (29911-28-2) |
Safety
| PPE | Eyeshields, Faceshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | UA8200000 |
| TSCA | TSCA listed |
| HS Code | 29094990 |
| Storage Class | 10 - Combustible liquids |




