A3369212
Dinoprostone? , 98% , 363-24-6
Synonym(s):
Dinoprostone;Prostaglandin E2;PGE?;PGE2;Prostaglandin E2
CAS NO.:363-24-6
Empirical Formula: C20H32O5
Molecular Weight: 352.47
MDL number: MFCD00077861
EINECS: 206-656-6
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB173.60 | In Stock |
|
| 5MG | RMB466.40 | In Stock |
|
| 10MG | RMB758.40 | In Stock |
|
| 25mg | RMB1428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68 °C |
| alpha | -85.5 º (c=1, C2H5OH) |
| Boiling point: | 406.07°C (rough estimate) |
| Density | 1.0601 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | -20°C |
| solubility | ethanol: 1 mg/mL |
| form | powder |
| pka | pKa 4.77± 0.09(H2O,t=25±0.1,I=0.1(NaCl)) (Uncertain) |
| color | Clear yellow to amber |
| biological source | synthetic (organic) |
| Water Solubility | insoluble |
| Merck | 14,7877 |
| BRN | 4709356 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| InChIKey | XEYBRNLFEZDVAW-ARSRFYASSA-N |
| SMILES | O[C@@H]1CC([C@H](C/C=C\CCCC(O)=O)[C@H]1/C=C/[C@@H](O)CCCCC)=O |
| CAS DataBase Reference | 363-24-6(CAS DataBase Reference) |
Description and Uses
Prostaglandin E2 (363-24-6; PGE2) is an endogenous prostaglandin derived from the action of cyclooxygenase on arachidonic acid. PGE2 has diverse biological actions in the areas of inflammation, cancer, immune modulation, fertility, smooth muscle relaxation and hematopoietic stem cell homeostasis. Prostaglandin E2 acts through four distinct receptors: EP1, EP2, EP3, EP4.
The most common and most biologically potent of mammalian prostaglandins. Isolated from sheep prostate. Oxytocic; abortifacient.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H360FD |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 60-22-61 |
| Safety Statements | 53-22-26-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | UK8000000 |
| F | 8-10 |
| HS Code | 29375000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 1B |







