LN4384449
ProstaglandinA2 , ≥98% , 13345-50-1
CAS NO.:13345-50-1
Empirical Formula: C20H30O4
Molecular Weight: 334.45
MDL number: MFCD00077859
EINECS: 634-333-3
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB328.00 | In Stock |
|
| 5mg | RMB1388.00 | In Stock |
|
| 10mg | RMB2060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 391.24°C (rough estimate) |
| Density | 1.0332 (rough estimate) |
| refractive index | 1.4434 (estimate) |
| Flash point: | -9 °C |
| storage temp. | −20°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Water (Slightly) |
| form | Neat oil. |
| pka | 4.75±0.10(Predicted) |
| color | Colourless to Dark Yellow |
| biological source | synthetic |
| Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C |
| InChI | 1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12-18,21H,2-3,5-6,8-11H2,1H3,(H,23,24)/b7-4-,14-12+/t16-,17-,18+/m0/s1 |
| InChIKey | MYHXHCUNDDAEOZ-FOSBLDSVSA-N |
| SMILES | CCCCC[C@H](O)\C=C\[C@H]1C=CC(=O)[C@@H]1C\C=C/CCCC(O)=O |
Description and Uses
Prostaglandin A2 is a naturally occurring prostaglandin in gorgonian corals where it may function in self defense. Prostaglandin A2 is generally not present in mammals. Prostaglandin A2 has low biological potency in most bioassays, but it does show some antiviral/antitumor activity. Prostaglandin A2 has also been shown to act as a vasodilator with natriuretic properties.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H361-H312 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P363-P501 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36-66-67 |
| Safety Statements | 26-16 |
| RIDADR | UN 1231 3/PG 2 |
| WGK Germany | 3 |
| F | 8-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Repr. 2 |







