A3372012
1,4-Dihydro-6,7-Dinitro-2,3-Quinoxalinedione , 98% , 2379-57-9
Synonym(s):
6,7-Dinitroquinoxaline-2,3(1H,4H)-dione;AMPA Glutamate Receptor Antagonist, DNQX, Kainate Glutamate Receptor Antagonist, DNQX;DNQX Disodium Salt - CAS 2379-57-9 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB256.00 | In Stock |
|
| 50MG | RMB653.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 395.32°C (rough estimate) |
| Density | 1.6919 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMSO |
| form | Pale yellow solid. |
| pka | 7.68±0.20(Predicted) |
| color | Off-White to Light Yellow |
| Water Solubility | H2O: 100mM |
| Stability: | Store in freezer at -20°C |
| InChI | InChI=1S/C8H4N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H,(H,9,13)(H,10,14) |
| InChIKey | RWVIMCIPOAXUDG-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C([N+]([O-])=O)C([N+]([O-])=O)=C2)NC(=O)C1=O |
| CAS DataBase Reference | 2379-57-9(CAS DataBase Reference) |
Description and Uses
DNQX has been used to block N-Methyl-D-aspartic acid (NMDA) and α-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid (AMPA) receptors in various experiments.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310-P321-P330-P302+P352-P304+P340-P311-P312-P361+P364-P403+P233-P405-P501 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






