A3379312
DL-2-Aminobutyric Acid Methyl Ester Hydrochloride , ≥98.0% , 7682-18-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB74.40 | In Stock |
|
| 5G | RMB160.80 | In Stock |
|
| 25G | RMB461.60 | In Stock |
|
| 100g | RMB1189.60 | In Stock |
|
| 500g | RMB3572.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO, Methanol, Water |
| form | Solid |
| color | White |
| Water Solubility | almost transparency |
| InChI | InChI=1S/C5H11NO2.ClH/c1-3-4(6)5(7)8-2;/h4H,3,6H2,1-2H3;1H |
| InChIKey | AHAQQEGUPULIOZ-UHFFFAOYSA-N |
| SMILES | C(N)(CC)C(=O)OC.Cl |
| CAS DataBase Reference | 7682-18-0 |
Description and Uses
Intermediate in the preparation of Ergonovine (E597800) derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29156000 |
