A7632912
L-Tyrosine methyl ester hydrochloride , 98% , 3417-91-2
CAS NO.:3417-91-2
Empirical Formula: C10H14ClNO3
Molecular Weight: 231.68
MDL number: MFCD00012607
EINECS: 222-313-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB161.60 | In Stock |
|
| 250g | RMB351.20 | In Stock |
|
| 500g | RMB631.20 | In Stock |
|
| 2.5kg | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192 °C (dec.)(lit.) |
| alpha | 74 º (c=3,1N pyridine) |
| refractive index | 13 ° (C=2, MeOH) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| Water Solubility | very faint turbidity in Water |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]25/D +74.0°, c = 3 in pyridine |
| Sensitive | Hygroscopic |
| BRN | 3917353 |
| Major Application | peptide synthesis |
| Cosmetics Ingredients Functions | HAIR CONDITIONING |
| InChI | InChI=1/C10H13NO3.ClH/c1-14-10(13)9(11)6-7-2-4-8(12)5-3-7;/h2-5,9,12H,6,11H2,1H3;1H/t9-;/s3 |
| InChIKey | VXYFARNRGZWHTJ-OVMXBOEKNA-N |
| SMILES | C1(C=CC(O)=CC=1)C[C@H](N)C(=O)OC.Cl |&1:8,r| |
| CAS DataBase Reference | 3417-91-2(CAS DataBase Reference) |
| EPA Substance Registry System | L-Tyrosine, methyl ester, hydrochloride (3417-91-2) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29225000 |
| Storage Class | 11 - Combustible Solids |






