A3399112
4,5-Dimethyl-2-nitroaniline , 97% , 6972-71-0
CAS NO.:6972-71-0
Empirical Formula: C8H10N2O2
Molecular Weight: 166.18
MDL number: MFCD00007811
EINECS: 230-211-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB216.00 | In Stock |
|
| 100G | RMB816.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141 °C(lit.) |
| Boiling point: | 314.38°C (rough estimate) |
| Density | 1.2275 (estimate) |
| refractive index | 1.6273 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder |
| pka | 0.71±0.25(Predicted) |
| Appearance | Light brown to reddish brown Solid |
| BRN | 2209637 |
| InChI | 1S/C8H10N2O2/c1-5-3-7(9)8(10(11)12)4-6(5)2/h3-4H,9H2,1-2H3 |
| InChIKey | PINGKGKKUSYUAW-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)c(cc1C)[N+]([O-])=O |
| CAS DataBase Reference | 6972-71-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4,5-Dimethyl-2-nitroaniline (6972-71-0) |
Description and Uses
Used to synthesize metal complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




