A3399812
Dimethyl 2,6-Naphthalenedicarboxylate , ≥99.0%(GC) , 840-65-3
CAS NO.:840-65-3
Empirical Formula: C14H12O4
Molecular Weight: 244.24
MDL number: MFCD00004100
EINECS: 212-661-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB100.80 | In Stock |
|
| 25G | RMB364.80 | In Stock |
|
| 100G | RMB1238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-193 °C(lit.) |
| Boiling point: | 347.16°C (rough estimate) |
| Density | 1.2379 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5389 (estimate) |
| Flash point: | 232°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in hot toluene (very faint turbidity). Insoluble in water. |
| BRN | 987259 |
| InChI | InChI=1S/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 |
| InChIKey | GYUVMLBYMPKZAZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(C(OC)=O)C=C2)=CC=C1C(OC)=O |
| LogP | 3.5 at 25℃ |
| CAS DataBase Reference | 840-65-3(CAS DataBase Reference) |
| EPA Substance Registry System | Dimethyl 2,6-naphthalenedicarboxylate (840-65-3) |
Description and Uses
Dimethyl naphthalene-2,6-dicarboxylate is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H372-H413 |
| Precautionary statements | P501-P273-P260-P270-P262-P271-P264-P280-P284-P314-P361+P364-P301+P310+P330-P302+P352+P310-P304+P340+P310-P403+P233-P405 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2917.39.7000 |








