A3400012
4,6-Dichloro-5-fluoropyrimidine , 97% , 213265-83-9
CAS NO.：213265-83-9
Empirical Formula: C4HCl2FN2
Molecular Weight: 166.97
MDL number: MFCD08056331
EINECS: 606-739-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1G | RMB68.80 | In Stock |
|
| 5G | RMB227.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 50-60℃/14mm |
| Density | 1.605±0.06 g/cm3(Predicted) |
| Flash point: | 91°(196°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO, Methanol (Slightly) |
| form | Liquid |
| pka | -5.42±0.26(Predicted) |
| color | Colourless |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C4HCl2FN2/c5-3-2(7)4(6)9-1-8-3/h1H |
| InChIKey | DGMIGAHDDPJOPN-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(F)C(Cl)=N1 |
Description and Uses
4,6-Dichloro-5-Fluoropyrimidine is an useful intermediate for pharmaceuticals.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H227-H314-H318 |
| Precautionary statements | P210e-P260h-P303+P361+P353-P305+P351+P338-P405-P501a |
| Safety Statements | 24/25 |
| RIDADR | UN3265 |
| HazardClass | IRRITANT |
| HazardClass | 8 |
| HS Code | 29335990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
