A3407912
1,1′-Diacetylferrocene , ≥98.0%(HPLC) , 1273-94-5
Synonym(s):
Bis(acetylcyclopentadienyl)iron
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.00 | In Stock |
|
| 5G | RMB204.80 | In Stock |
|
| 25G | RMB767.20 | In Stock |
|
| 100G | RMB2233.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-127 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| Appearance | Brown to reddish brown Solid |
| Water Solubility | Insoluble |
| InChI | InChI=1S/2C7H7O.Fe/c2*1-6(8)7-4-2-3-5-7;/h2*2-5H,1H3; |
| InChIKey | JNBIZDIDVCJECQ-UHFFFAOYSA-N |
| SMILES | [C]1([CH][CH][CH][CH]1)C(=O)C.[C]1([CH][CH][CH][CH]1)C(=O)C.[Fe] |^1:0,1,2,3,4,8,9,10,11,12| |
| CAS DataBase Reference | 1273-94-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1'-Diacetylferrocene(1273-94-5) |
Description and Uses
1,1′-Diacetylferrocene is an organic compound used as a catalyst or ligand in certain cross-coupling reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | LK0725666 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| Toxicity | mammal (species unspecified),LDLo,intratracheal,50mg/kg (50mg/kg),BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLDBEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)KIDNEY, URETER, AND BLADDER: INCONTINENCE,"Spravochnik po Toksikologii i Gigienicheskim Normativam Vol. -, Pg. 62, 1999. |





