PRODUCT Properties
| Boiling point: | 264 °C(lit.) |
| Density | 1.256 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| color | red-orange |
| Specific Gravity | 1.256 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| InChI | InChI=1S/C7H9.C5H5.Fe/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h3-6H,2H2,1H3;1-5H; |
| InChIKey | XEYMPZDIHJESAH-UHFFFAOYSA-N |
| SMILES | [C]1(CC)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,3,4,5,6,7,8,9,10,11| |
| CAS DataBase Reference | 1273-89-8 |
| NIST Chemistry Reference | Ferrocene, ethyl-(1273-89-8) |
| EPA Substance Registry System | Ferrocene, ethyl- (1273-89-8) |
Description and Uses
Ethylferrocene is used in the development of photosensitive GEMs with resistive electrodes manufactured via screen printing 1.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360-H410-H373-H332-H302 |
| Precautionary statements | P260-P314-P501-P273-P391-P501-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312 |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29319090 |
