A3409012
Di-tert-butyl N,N-diisopropylphosphoramidite , ≥95.0% , 137348-86-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB198.40 | In Stock |
|
| 25g | RMB652.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85-90 °C/0.2 mmHg (lit.) |
| Density | 0.879 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.90±0.70(Predicted) |
| form | Liquid |
| color | Clear colorless |
| BRN | 4858847 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C14H32NO2P/c1-11(2)15(12(3)4)18(16-13(5,6)7)17-14(8,9)10/h11-12H,1-10H3 |
| InChIKey | YGFLCNPXEPDANQ-UHFFFAOYSA-N |
| SMILES | P(N(C(C)C)C(C)C)(OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 137348-86-8(CAS DataBase Reference) |
Description and Uses
Di-tert-butyl N,N-diisopropylphosphoramidite is a general reagent to introduce tert-butyl-protected phosphate groups. It is commonly used in phosphorylation of biomolecules. It can also be used in the synthesis of phosphoramidate-linked glycoconjugates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



