BD7910331
Di-tert-butyl diethylphosphoramidite , 98% , 117924-33-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB149.60 | In Stock |
|
| 25g | RMB636.80 | In Stock |
|
| 100g | RMB2112.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 39-41 °C/0.3 mmHg (lit.) |
| Density | 0.896 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 173 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| pka | 4.41±0.70(Predicted) |
| color | Clear Colourless |
| Water Solubility | Hydrolyzes in water. Soluble in chloroform and methanol. |
| Sensitive | Moisture Sensitive |
| BRN | 4175262 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C12H28NO2P/c1-9-13(10-2)16(14-11(3,4)5)15-12(6,7)8/h9-10H2,1-8H3 |
| InChIKey | KUKSUQKELVOKBH-UHFFFAOYSA-N |
| SMILES | P(N(CC)CC)(OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 117924-33-1(CAS DataBase Reference) |
Description and Uses
Di-tert-butyl N,N-diethylphosphoramidite is a useful reagent for the efficient phosphorylative conversion of alcohols into their corresponding dibenzylphosphorotriesters.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 4.4-10-21 |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




