A3436112
3,5-Dinitrobenzyl Alcohol , >98.0% , 71022-43-0
CAS NO.:71022-43-0
Empirical Formula: C7H6N2O5
Molecular Weight: 198.13
MDL number: MFCD00007235
EINECS: 275-131-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB109.60 | In Stock |
|
| 5G | RMB303.20 | In Stock |
|
| 25G | RMB1048.80 | In Stock |
|
| 100g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-91 °C (lit.) |
| Boiling point: | 335.43°C (rough estimate) |
| Density | 1.560±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5460 (estimate) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 13.40±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 2054388 |
| InChI | InChI=1S/C7H6N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-3,10H,4H2 |
| InChIKey | GPHYIQCSMDYRGJ-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 71022-43-0(CAS DataBase Reference) |
Description and Uses
3,5-Dinitrobenzyl alcohol was used in the synthesis of 3,5-bis((bezoxycarbonyl)imino)benzyl alcohol.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |






