A3441212
2,6-Dichloro-4-pyridinemethanol , >98.0% , 101990-69-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB88.80 | In Stock |
|
| 1G | RMB226.40 | In Stock |
|
| 5G | RMB737.60 | In Stock |
|
| 25g | RMB3014.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 0°C |
| Boiling point: | 0°C |
| Density | 1.478±0.06 g/cm3(Predicted) |
| Flash point: | 0°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.72±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C6H5Cl2NO/c7-5-1-4(3-10)2-6(8)9-5/h1-2,10H,3H2 |
| InChIKey | YDGJTFCKLFLWFM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC(CO)=C1 |
| CAS DataBase Reference | 101990-69-6(CAS DataBase Reference) |
Description and Uses
2,6-Dichloro-4-pyridinemethanol is a reagent in the preparation of functionalized compounds such as bipyridines and terpyridines via Stille-type cross coupling. Also used in the preparation of fluorescent chemosensors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
