PRODUCT Properties
| Melting point: | 195-197℃ |
| Boiling point: | 346.76°C (rough estimate) |
| Density | 1.420 |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:4): 0.20 mg/ml |
| form | powder |
| pka | 6.48±0.40(Predicted) |
| color | Yellow |
| Major Application | food and beverages |
| InChI | InChI=1S/C16H12O5/c1-20-16-11(18)8-13-14(15(16)19)10(17)7-12(21-13)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
| InChIKey | LKOJGSWUMISDOF-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1 |
Description and Uses
food and beverages
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
