PRODUCT Properties
| Melting point: | 267°C |
| Boiling point: | 659.1±55.0 °C(Predicted) |
| Density | 1.605 |
| Flash point: | 90℃ |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol; |
| form | powder |
| pka | 6.48±0.40(Predicted) |
| color | Yellow |
| Water Solubility | slightly soluble in water |
| InChI | InChI=1S/C16H12O7/c1-22-16-11(20)6-13-14(15(16)21)10(19)5-12(23-13)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
| InChIKey | FHHSEFRSDKWJKJ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1 |
Description and Uses
Nepetin can be anti-tumor, insecticide, anti-SARS virus, and antibacterial.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
