A3446712
Dichloramine T , >96.0%(T) , 473-34-7
Synonym(s):
Dichloramine T
CAS NO.:473-34-7
Empirical Formula: C7H7Cl2NO2S
Molecular Weight: 240.11
MDL number: MFCD00058929
EINECS: 207-462-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB229.60 | In Stock |
|
| 100G | RMB295.20 | In Stock |
|
| 500G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79°C |
| Boiling point: | 330℃ |
| Density | 1.491 |
| refractive index | 1.6000 (estimate) |
| Flash point: | 153℃ |
| storage temp. | -20°C |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | -27.61±0.70(Predicted) |
| color | White to Light yellow |
| Merck | 14,3047 |
| InChI | 1S/C7H7Cl2NO2S/c1-6-2-4-7(5-3-6)13(11,12)10(8)9/h2-5H,1H3 |
| InChIKey | ARGDYOIRHYLIMT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)N(Cl)Cl |
| EPA Substance Registry System | Benzenesulfonamide, N,N-dichloro-4-methyl- (473-34-7) |
Description and Uses
N,N-Dichloro-p-toluenesulfonamide (TsNCl2) can be used as:
- A nitrogen source for the preparation of aziridines from electron-deficient α,β-unsaturated alkenes in the presence of palladium catalyst.
- A reagent in the synthesis of dichlorohaloamines by aminohalogenation of functionalized olefins using copper(I) chloride or 4-dimethylaminopyridine (DMAP) catalyst.
- A chlorinating agent in the regioselective synthesis of α-mono chlorosulfoxides from dialkyl sulfoxides or alkyl aryl sulfoxides.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Danger |
| Hazard statements | H271-H315-H319-H335 |
| Precautionary statements | P210-P221-P264-P280-P283-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P306+P360-P371+P380+P375-P501-P220-P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | O,Xi |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 17-26-36/37/39 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | I |
| HS Code | 29350090 |
| Storage Class | 5.1A - Strongly oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 1 Skin Irrit. 2 STOT SE 3 |







