A3449912
2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl Acrylate (stabilized with TBC) , >97.0%(GC) , 2993-85-3
Synonym(s):
DFHA
CAS NO.:2993-85-3
Empirical Formula: C10H6F12O2
Molecular Weight: 386.13
MDL number: MFCD00080746
EINECS: 221-064-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25g | RMB660.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 197 °C (lit.) |
| Density | 1.581 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.581 |
| BRN | 3563773 |
| InChI | InChI=1S/C10H6F12O2/c1-2-4(23)24-3-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h2,5H,1,3H2 |
| InChIKey | QJEJDNMGOWJONG-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C=C |
| CAS DataBase Reference | 2993-85-3(CAS DataBase Reference) |
| EPA Substance Registry System | (6H-Perfluorohexyl)methyl acrylate (2993-85-3) |
Description and Uses
1H,1H,7H-Dodecafluoroheptyl Acrylate (CAS# 2993-85-3) is a polymerizable liquid crystal that can be used as an optically anisotropic film, optical film, polarizing plate, and image display device. It can also be used to produce particulate vinyliden-fluoride-based polymer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UD3340500 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, KEEP COLD |
| HazardClass | 9 |
| HS Code | 29161290 |







