A4801812
1<i>H</i>,1<i>H</i>,5<i>H</i>-Octafluoropentyl Acrylate (stabilized with MEHQ) , >97.0%(GC) , 376-84-1
Synonym(s):
OFPA
CAS NO.:376-84-1
Empirical Formula: C8H6F8O2
Molecular Weight: 286.12
MDL number: MFCD00039279
EINECS: 206-816-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.00 | In Stock |
|
| 5G | RMB168.00 | In Stock |
|
| 25G | RMB676.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 122 °C/140 mmHg (lit.) |
| Density | 1.488 g/mL at 25 °C (lit.) |
| refractive index | n |
| RTECS | UD3643645 |
| Flash point: | 161 °F |
| storage temp. | 2-8°C |
| Water Solubility | Practically insoluble in water |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.481 |
| InChI | InChI=1S/C8H6F8O2/c1-2-4(17)18-3-6(11,12)8(15,16)7(13,14)5(9)10/h2,5H,1,3H2 |
| InChIKey | WISUNKZXQSKYMR-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C=C |
| CAS DataBase Reference | 376-84-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1h,1h,5h-Octafluoropentyl acrylate(376-84-1) |
| EPA Substance Registry System | 2-Propenoic acid, 2,2,3,3,4,4,5,5-octafluoropentyl ester (376-84-1) |
Description and Uses
1H,1H,5H-octafluoropentyl acrylate (OFPA) belongs to fluorinated acrylates having different fluoroalkyl chains. Two Y-shaped molecules, combining two dissimilar (hydrophilic and hydrophobic) units with a reactive triethoxysilane moiety, were synthesized by Koizumi et al. The synthesis involved a Michael addition reaction of (aminopropyl)triethoxysilane with 2-hydroxyethyl acrylate (HEA), followed by the addition of either 2,2,2-trifluoroethyl acrylate (TFEA) or 1H,1H,5H-octafluoropentyl acrylate (OFPA)[1].
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H411 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N,F |
| Risk Statements | 36/37/38-51/53 |
| Safety Statements | 26-28-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Flammable/Keep Cold |
| HazardClass | KEEP COLD, FLAMMABLE |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







