A3472312
4,5-Dichlorophthalonitrile , >98.0%(GC) , 139152-08-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB79.20 | In Stock |
|
| 1g | RMB239.20 | In Stock |
|
| 5G | RMB583.20 | In Stock |
|
| 25G | RMB2895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-184 °C (lit.) |
| Boiling point: | 312.4±42.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in hot Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H2Cl2N2/c9-7-1-5(3-11)6(4-12)2-8(7)10/h1-2H |
| InChIKey | SRIJSZQFAMLVQV-UHFFFAOYSA-N |
| SMILES | C1(C#N)=CC(Cl)=C(Cl)C=C1C#N |
| CAS DataBase Reference | 139152-08-2 |
Description and Uses
4,5-Dichlorophthalonitrile is suitable as a reactant in the synthesis of 4,5-bis(3,4-dimethoxyphenyl) phthalonitrile and 4,5-bis(2,6-dimethoxyphenoxy) phthalonitrile. It may be used in the synthesis of 4,5-diphenoxyphthalonitrile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







