A3481412
2,5-Dimethoxy-3-nitrobenzoic Acid , >98.0% , 17894-26-7
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB343.20 | In Stock |
|
| 1G | RMB1208.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-187 °C (lit.) |
| Boiling point: | 368.87°C (rough estimate) |
| Density | 1.4777 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C9H9NO6/c1-15-5-3-6(9(11)12)8(16-2)7(4-5)10(13)14/h3-4H,1-2H3,(H,11,12) |
| InChIKey | QCJROOYLFVYZEP-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)=O)c(OC)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 17894-26-7(CAS DataBase Reference) |
Description and Uses
2,5-Dimethoxy-3-nitrobenzoic acid is a substituted nitrobenzoic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
