A3483712
3,4-Dihydroxybenzophenone , ≥98.0% , 10425-11-3
CAS NO.:10425-11-3
Empirical Formula: C13H10O3
Molecular Weight: 214.22
MDL number: MFCD00477203
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.80 | In Stock |
|
| 25G | RMB124.00 | In Stock |
|
| 100G | RMB396.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-148 °C (lit.) |
| Boiling point: | 314.35°C (rough estimate) |
| Density | 1.1956 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.02±0.18(Predicted) |
| color | White to Light yellow to Green |
| InChI | InChI=1S/C13H10O3/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8,14-15H |
| InChIKey | ARWCZKJISXFBGI-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C(O)=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 10425-11-3(CAS DataBase Reference) |
Description and Uses
3,4-Dihydroxybenzophenone is used as pharmaceutical intermediates, photosensitive dye intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |






