A3484412
Digitoxigenin , >95.0%(HPLC) , 143-62-4
Synonym(s):
3β,14-Dihydroxy-5β,20(22)-cardenolide;3,14,21-Trihydroxy-20(22)-norcholenic acid lactone;5β,20(22)-Cardenolide-3β,14-diol
CAS NO.:143-62-4
Empirical Formula: C23H34O4
Molecular Weight: 374.51
MDL number: MFCD00003687
EINECS: 205-603-4
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB103.20 | In Stock |
|
| 10MG | RMB425.60 | In Stock |
|
| 5mg | RMB439.20 | In Stock |
|
| 25mg | RMB1919.20 | In Stock |
|
| 50mg | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253-255 °C (dec.)(lit.) |
| Boiling point: | 423.5°C (rough estimate) |
| alpha | D17 +19.1° (c = 1.36 in methanol) |
| Density | 1.0284 (rough estimate) |
| refractive index | 1.4433 (estimate) |
| storage temp. | Store at -20°C |
| solubility | DMF: 25 mg/ml; DMF:PBS(pH 7.2)(1:1): 0.5 mg/ml; DMSO: 20 mg/ml; Ethanol: 5 mg/ml |
| form | powder to crystal |
| pka | 14.93±0.70(Predicted) |
| color | White to Almost white |
| optical activity | +2323 (c 0.5, CHCl3) |
| Water Solubility | 11.24mg/L(30 ºC) |
| Merck | 14,3162 |
| BRN | 95448 |
| Stability: | Hygroscopic |
| InChIKey | XZTUSOXSLKTKJQ-CESUGQOBSA-N |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@]([H])(CC[C@]34O)C5=CC(=O)OC5)[C@@]1(C)CC[C@H](O)C2 |
| LogP | 2.640 |
| CAS DataBase Reference | 143-62-4(CAS DataBase Reference) |
Description and Uses
Cardiotonic;Na+ K+ ATPase inhibitor
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 3462 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | FH4975000 |
| HS Code | 2938.90.0000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
| Toxicity | cat,LDLo,intravenous,254ug/kg (0.254mg/kg),GASTROINTESTINAL: NAUSEA OR VOMITING,Journal of the American Pharmaceutical Association. Vol. 27, Pg. 189, 1938. |






