A6963758
Digoxigenin , 10mMinDMSO , 1672-46-4
Synonym(s):
3β,12β,14β,21-Tetrahydroxy-20(22)-norcholenic acid lactone;3β,12β,14-Trihydroxy-5β,20(22)-cardenolide;5β,20(22)-Cardenolide-3β,12β,14-triol;Lanadigigenin
CAS NO.:1672-46-4
Empirical Formula: C23H34O5
Molecular Weight: 390.51
MDL number: MFCD00871861
EINECS: 216-806-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222 °C(lit.) |
| Boiling point: | 435.71°C (rough estimate) |
| Density | 1.0639 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | room temp |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.44±0.70(Predicted) |
| color | White to off-white |
| Merck | 13,3188 |
| BRN | 96479 |
| Major Application | environmental food and beverages forensics and toxicology veterinary |
| InChIKey | SHIBSTMRCDJXLN-KCZCNTNESA-N |
| SMILES | C[C@]12CC[C@H](O)C[C@H]1CC[C@@H]3[C@@H]2C[C@@H](O)[C@]4(C)[C@H](CC[C@]34O)C5=CC(=O)OC5 |
| CAS DataBase Reference | 1672-46-4(CAS DataBase Reference) |
| EPA Substance Registry System | Card-20(22)-enolide, 3,12,14-trihydroxy-, (3.beta.,5.beta,12.beta.)- (1672-46-4) |
Description and Uses
cardiotonic, positive inotropic activity
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | FH5390000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 1 Oral Acute Tox. 2 Dermal |
| Hazardous Substances Data | 1672-46-4(Hazardous Substances Data) |





