LN263189
b-Acetyl digoxin , ≥95% , 5355-48-6
Synonym(s):
β-Acetyldigoxin;Digoxin 4″′-acetate
CAS NO.:5355-48-6
Empirical Formula: C43H66O15
Molecular Weight: 822.98
MDL number: MFCD00242932
EINECS: 226-337-5
| Pack Size | Price | Stock | Quantity |
| 2mg | RMB7903.20 | In Stock |
|
| 5mg | RMB16757.60 | In Stock |
|
| 10mg | RMB26376.00 | In Stock |
|
| 20mg | RMB50235.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 271-273°C |
| alpha | D20 +30.4° (c = 1.2 in alc) |
| Boiling point: | 681.03°C (rough estimate) |
| Density | 1.1139 (rough estimate) |
| refractive index | 1.5940 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Practically insoluble in water, sparingly soluble in methylene chloride, slightly soluble in ethanol (96 per cent). |
| pka | 13.41±0.70(Predicted) |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | NREAGDHHMSOWKZ-UHFFFAOYSA-N |
| SMILES | O1CC(=CC1=O)C2C3(C(C4C(C5(C(CC4)CC(CC5)OC6OC(C(C(C6)O)OC7OC(C(C(C7)O)OC8OC(C(C(C8)O)OC(=O)C)C)C)C)C)CC3O)(CC2)O)C |
Description and Uses
Digoxin derivative, a cardiotonic glycosides
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330 |
| Precautionary statements | P260-P301+P330+P331+P310-P304+P340+P310-P403+P233 |
| RIDADR | 3249 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |






