A3488212
3-(Dimethylamino)propyl Chloride Hydrochloride , >98.0%(T) , 5407-04-5
Synonym(s):
2-Chloro-1-dimethylaminopropane hydrochloride, 2-DMPC, 2-Chloro-N,N-dimethylpropylamine hydrochloride, 1-Dimethylaminoisopropyl chloride hydrochloride;N-(2-Chloropropyl)-N,N-dimethylammonium chloride
CAS NO.：5407-04-5
Empirical Formula: C5H13Cl2N
Molecular Weight: 158.07
MDL number: MFCD00012521
EINECS: 226-467-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB95.20 | In Stock |
|
| 500G | RMB383.20 | In Stock |
|
| 2.5kg | RMB1750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-190 °C(lit.) |
| Boiling point: | 50 °C(Press: 40 Torr) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 2000g/l |
| form | Solid |
| color | White to Off-White |
| PH | 5-6 (500g/l, H2O, 20℃) |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 3670046 |
| InChI | InChI=1S/C5H12ClN.ClH/c1-7(2)5-3-4-6;/h3-5H2,1-2H3;1H |
| InChIKey | LJQNMDZRCXJETK-UHFFFAOYSA-N |
| SMILES | C(CCCl)N(C)C.Cl |
| CAS DataBase Reference | 5407-04-5(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Chloro-N,N-dimethyl-1-propanamine hydrochloride (5407-04-5) |
Description and Uses
3-(Dimethylamino)propyl chloride hydrochloride (DMPC) is used as intermediate for the syntheses of pharmaceuticals (e.g. amitriptyline, bencyclane, benzydamine, cyclobenzaprine and imipramine). Product Data Sheet
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-52/53 |
| Safety Statements | 26-61-37/39-36 |
| WGK Germany | 3 |
| RTECS | TY1225000 |
| F | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29211990 |
