A3492612
3,4-Diaminobenzophenone , 98% , 39070-63-8
Synonym(s):
3,4-Diaminobenzophenone;4-Benzoyl-o-phenylenediamine
CAS NO.:39070-63-8
Empirical Formula: C13H12N2O
Molecular Weight: 212.25
MDL number: MFCD00007727
EINECS: 254-273-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB287.20 | In Stock |
|
| 100G | RMB1119.20 | In Stock |
|
| 500g | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 °C (lit.) |
| Boiling point: | 352.09°C (rough estimate) |
| Density | 1.1128 (rough estimate) |
| refractive index | 1.6920 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 0.4g/l |
| pka | 2.96±0.10(Predicted) |
| form | Powder |
| color | Yellow to ochre-yellow |
| Water Solubility | 410 mg/L (20 ºC) |
| BRN | 2212487 |
| InChI | InChI=1S/C13H12N2O/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8H,14-15H2 |
| InChIKey | RXCOGDYOZQGGMK-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C(N)=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 39070-63-8(CAS DataBase Reference) |
Description and Uses
3,4-Diaminobenzophenone is used in the synthesis of 2-Amino-5(6)-benzoylbenzimidazole (A593760), which is a minor urinary metabolite of Mebendazole (M200500) in man. Mebendazole impurity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 9-23 |
| Autoignition Temperature | 550°C |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![7,16-Dichlorodinaphtho[2,3-a:2',3'-h]phenazine-5,9,14,18(6H,15H)-tetraone](https://img.chemicalbook.com/CAS/GIF/130-20-1.gif)

