A3494812
3,5-Diphenylpyrazole , >98.0%(HPLC) , 1145-01-3
CAS NO.:1145-01-3
Empirical Formula: C15H12N2
Molecular Weight: 220.27
MDL number: MFCD00039675
EINECS: 214-543-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100G | RMB834.40 | In Stock |
|
| 500g | RMB2495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199-203 °C (lit.) |
| Boiling point: | 351.21°C (rough estimate) |
| Density | 1.1405 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.04±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| BRN | 158264 |
| InChI | InChI=1S/C15H12N2/c1-3-7-12(8-4-1)14-11-15(17-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| InChIKey | JXHKUYQCEJILEI-UHFFFAOYSA-N |
| SMILES | N1C(C2=CC=CC=C2)=CC(C2=CC=CC=C2)=N1 |
| EPA Substance Registry System | 1H-Pyrazole, 3,5-diphenyl- (1145-01-3) |
Description and Uses
3,5-Diphenylpyrazole is an intermediate of the herbicides glyphosate and fenvalerate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335-H413 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







