A3527412
Disodium Anthraquinone-2,6-disulfonate , >98.0%(HPLC)(T) , 853-68-9
CAS NO.:853-68-9
Empirical Formula: C14H9NaO8S2
Molecular Weight: 392.33
MDL number: MFCD00001230
EINECS: 212-719-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB79.20 | In Stock |
|
| 1G | RMB319.20 | In Stock |
|
| 5G | RMB1119.20 | In Stock |
|
| 25G | RMB3920.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 325 °C |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | H2O: 10 mg/mL, clear |
| form | Solid |
| color | White to Pale Yellow |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H8O8S2.Na.H/c15-13-9-3-1-7(23(17,18)19)5-11(9)14(16)10-4-2-8(6-12(10)13)24(20,21)22;;/h1-6H,(H,17,18,19)(H,20,21,22);; |
| InChIKey | HYIFCKFCRGCAGY-UHFFFAOYSA-N |
| SMILES | O=C1C2=CC=C(S(O)(=O)=O)C=C2C(=O)C2C=CC(S(O)(=O)=O)=CC1=2.[NaH] |
| CAS DataBase Reference | 853-68-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2,6-Anthracenedisulfonic acid, 9,10-dihydro-9,10-dioxo-, disodium salt (853-68-9) |
Description and Uses
Disodium anthraquinone-2,6-disulfonate is an anthraquinone compound for proteomics research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29147000 |







