A3561112
3,4-Dihydro-4-oxo-1,2,3-benzotriazine , >98.0%(HPLC) , 90-16-4
CAS NO.:90-16-4
Empirical Formula: C7H5N3O
Molecular Weight: 147.13
MDL number: MFCD00052387
EINECS: 201-971-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5G | RMB132.00 | In Stock |
|
| 25G | RMB382.40 | In Stock |
|
| 100g | RMB1495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-218 °C (lit.) |
| Boiling point: | 282℃ |
| Density | 1.47 |
| refractive index | 1.5500 (estimate) |
| Flash point: | 125℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in most organic solvents. |
| pka | -4.67±0.20(Predicted) |
| form | Solid |
| color | Needles from cyclohexane |
| BRN | 124996 |
| Henry's Law Constant | 3.1×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C7H5N3O/c11-7-5-3-1-2-4-6(5)8-10-9-7/h1-4H,(H,8,9,11) |
| InChIKey | DMSSTTLDFWKBSX-UHFFFAOYSA-N |
| SMILES | N1C2=CC=CC=C2C(=O)NN=1 |
| CAS DataBase Reference | 90-16-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2,3-Benzotriazin-4(1H)-one (90-16-4) |
Description and Uses
1,2,3-Benzotriazin-4(3H)one is used to prepare 3-methoxymethyl-3H-benzo[d][1,2,3]triazin-4-one by reacting with dimethoxymethane. Further, it undergoes thermal condensation with alfa-amino acids to give 3H-1,4-benzodiazepin-(1H,4H)-2,5-diones. In addition to this, it is employed as a reagent to synthesize 1,2,3-bBenzotriazin-4-one-arylpiperazine derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DM0800000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2933698090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 90-16-4(Hazardous Substances Data) |
| Toxicity | LD50 ipr-mus: 50 mg/kg NTIS** AD277-689 |







