A3564512
2,6-Dimethoxytoluene , >98.0%(GC) , 5673-07-4
CAS NO.:5673-07-4
Empirical Formula: C9H12O2
Molecular Weight: 152.19
MDL number: MFCD00008374
EINECS: 227-131-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB111.20 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-41 °C (lit.) |
| Boiling point: | 222 °C |
| Density | 1,112g/cm |
| refractive index | 1.5240 (estimate) |
| Flash point: | 206 °F |
| form | powder to crystal |
| color | White or Colorless |
| Water Solubility | Insoluble in water. |
| BRN | 2045327 |
| InChI | InChI=1S/C9H12O2/c1-7-8(10-2)5-4-6-9(7)11-3/h4-6H,1-3H3 |
| InChIKey | FPEUDBGJAVKAEE-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=CC(OC)=C1C |
| LogP | 2.870 |
| CAS DataBase Reference | 5673-07-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,3-dimethoxy-2-methyl- (5673-07-4) |
Description and Uses
2,6-Dimethoxytoluene is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 2909.30.6000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




