A3588012
3',4'-Dimethoxyflavone , >98.0%(HPLC) , 4143-62-8
Synonym(s):
2-(3,4-Dimethoxyphenyl)chromen-4-one;3′,4′-DMF
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB239.20 | In Stock |
|
| 200MG | RMB411.20 | In Stock |
|
| 500mg | RMB799.20 | In Stock |
|
| 1G | RMB1216.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-155°C |
| Boiling point: | 428.5±45.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| color | white to off-white |
| λmax | 334nm(MeOH)(lit.) |
| BRN | 236749 |
| InChI | 1S/C17H14O4/c1-19-15-8-7-11(9-17(15)20-2)16-10-13(18)12-5-3-4-6-14(12)21-16/h3-10H,1-2H3 |
| InChIKey | ZGHORMOOTZTQFL-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1OC)C2=CC(=O)c3ccccc3O2 |
| LogP | 3.650 (est) |
| CAS DataBase Reference | 4143-62-8(CAS DataBase Reference) |
Description and Uses
3′,4′-Dimethoxyflavone has been used in urease inhibition assay.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 22-24/25-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| RTECS | DJ3012950 |
| HS Code | 2932.99.7000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
