A3604212
3,5-Dimethylnitrobenzene , >98.0% , 99-12-7
Synonym(s):
5-Nitro-m-xylene
CAS NO.：99-12-7
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00007269
EINECS: 202-732-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-74 °C(lit.) |
| Boiling point: | 273 °C739 mm Hg(lit.) |
| Density | 1.1446 (estimate) |
| refractive index | 1.5359 (estimate) |
| Flash point: | 273°C |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| Water Solubility | Insoluble in water. |
| BRN | 1936130 |
| InChI | 1S/C8H9NO2/c1-6-3-7(2)5-8(4-6)9(10)11/h3-5H,1-2H3 |
| InChIKey | BYFNZOKBMZKTSC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 99-12-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Nitro-m-xylene(99-12-7) |
| EPA Substance Registry System | 5-Nitro-m-xylene (99-12-7) |
Description and Uses
5-Nitro-m-xylene was used in aerobic oxidation of aromatic anilines to aromatic azo compounds using gold nanoparticles supported on TiO2 as a catalyst.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H301-H311-H331 |
| Precautionary statements | P260-P262-P264-P270-P271-P280-P284-P301+P310+P330-P302+P352+P310+P361+P364-P304+P340+P310-P403+P233-P405-P501-P261-P280h-P301+P310a-P304+P340-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn |
| Risk Statements | 23/24/25-33-20/21/22-36/37/38 |
| Safety Statements | 45-36/37-36/37/39-26-13 |
| RIDADR | UN 3447 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral STOT RE 2 |
