A3605812
3,4-Dichloronitrobenzene , >97.0%(GC) , 99-54-7
Synonym(s):
1,2-Dichloro-4-nitrobenzene;3,4-Dichloro-1-nitrobenzene, 1-Nitro-3.4-dichlorine benzene;3,4-Dichloronitrobenzene;asym.-Nitro-o-dichlorobenzene
CAS NO.:99-54-7
Empirical Formula: C6H3Cl2NO2
Molecular Weight: 192
MDL number: MFCD00007207
EINECS: 202-764-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-41 °C(lit.) |
| Boiling point: | 255-256 °C(lit.) |
| bulk density | 750kg/m3 |
| Density | 1.48 g/cm3 (55℃) |
| vapor pressure | 0.01 hPa (20 °C) |
| refractive index | 1.5929 (estimate) |
| Flash point: | 255 °F |
| storage temp. | Store below +30°C. |
| solubility | 0.151g/l |
| form | Crystalline Mass |
| color | Yellow to brown |
| Water Solubility | 151 mg/L (20 ºC) |
| FreezingPoint | 30~31℃ |
| BRN | 1818163 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C6H3Cl2NO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| InChIKey | NTBYINQTYWZXLH-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Cl)c(Cl)c1 |
| CAS DataBase Reference | 99-54-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2-dichloro-4-nitro-(99-54-7) |
| EPA Substance Registry System | 3,4-Dichloronitrobenzene (99-54-7) |
Description and Uses
1,2-Dichloro-4-nitrobenzene is an intermediate in the synthesis of agrochemicals. Studies have been conducted to use 1,2-Dichloro-4-nitrobenzene as an organic intermediate for the synthetic preparation of ciprofloxacin (C482500).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-43-51/53 |
| Safety Statements | 26-36/37-61-39-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CZ5250000 |
| Autoignition Temperature | 420 °C |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 99-54-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 643 mg/kg LD50 dermal Rat > 2000 mg/kg |




