A3612412
3,5-Dibromobenzoic Acid , >95.0% , 618-58-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 1g | RMB23.20 | In Stock |
|
| 25G | RMB91.20 | In Stock |
|
| 100g | RMB319.20 | In Stock |
|
| 500g | RMB1468.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-220 °C (lit.) |
| Boiling point: | 355.2±32.0 °C(Predicted) |
| Density | 1.9661 (rough estimate) |
| refractive index | 1.4970 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Very faint turbidity in methanol. |
| form | powder to crystal |
| pka | 3.42±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 1940691 |
| InChI | InChI=1S/C7H4Br2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChIKey | SFTFNJZWZHASAQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC(Br)=C1 |
| CAS DataBase Reference | 618-58-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dibromobenzoic acid(618-58-6) |
Description and Uses
3,5-Dibromobenzoic acid may be used for the syntheses (+)-menthyl 3,5-dibromobenzoate, di-tert-butyl 4-[2-(tert-butoxycarbonyl)ethyl]-4-(3,5-dibromobenzamido)heptanedioate2, (L)-methyl 2-(3,5-dibromobenzamido)-3-phenylpropanoate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DG6290010 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







