A3612512
3,5-Dimethoxyphenylacetic Acid , >98.0% , 4670-10-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB134.40 | In Stock |
|
| 25g | RMB599.20 | In Stock |
|
| 100g | RMB1897.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-103 °C(lit.) |
| Boiling point: | 293.08°C (rough estimate) |
| Density | 1.2166 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.08±0.10(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C10H12O4/c1-13-8-3-7(5-10(11)12)4-9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12) |
| InChIKey | FFPAFDDLAGTGPQ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(OC)=CC(OC)=C1 |
| CAS DataBase Reference | 4670-10-4(CAS DataBase Reference) |
Description and Uses
3,5-Dimethoxyphenylacetic Acid is a general reactant/reagent used in the synthesis of a recyclable, immobilized analogue of Benzotetramisole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/37 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |






