BD8134231
(S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid , 97% , 195202-08-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB114.40 | In Stock |
|
| 250mg | RMB185.60 | In Stock |
|
| 1g | RMB725.60 | In Stock |
|
| 5g | RMB2427.20 | In Stock |
|
| 10g | RMB4459.20 | In Stock |
|
| 25g | RMB8800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89°C |
| Boiling point: | 378.9±42.0 °C(Predicted) |
| Density | 1.142±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), methanol (Sparingly) |
| pka | 4.28±0.14(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C13H18O5/c1-5-9(13(14)15)8-6-10(16-2)12(18-4)11(7-8)17-3/h6-7,9H,5H2,1-4H3,(H,14,15)/t9-/s3 |
| InChIKey | WBULUDGUWZFLMO-DJEYLCQNNA-N |
| SMILES | C1=C(C(OC)=C(C=C1[C@H](CC)C(=O)O)OC)OC |&1:8,r| |
Description and Uses
(S)-2-(3,4,5-Trimethoxyphenyl)butyric Acid, is a building block used in various chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| HS Code | 2915601990 |
