A3811412
Dimethyl pyridine-2,5-dicarboxylate , 97% , 881-86-7
Synonym(s):
Methyl 6-methoxycarbonyl nicotinate
CAS NO.:881-86-7
Empirical Formula: C9H9NO4
Molecular Weight: 195.17
MDL number: MFCD00034767
EINECS: 629-154-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5g | RMB86.40 | In Stock |
|
| 25g | RMB802.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-217 °C(lit.) |
| Boiling point: | 302.9±22.0 °C(Predicted) |
| Density | 1.231±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Dichloromethane, Ethyl Acetate |
| pka | -0.35±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in Dichloromethane and Ethyl Acetate. Insoluble in water. |
| BRN | 172251 |
| InChI | InChI=1S/C9H9NO4/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2/h3-5H,1-2H3 |
| InChIKey | TUGSJNQAIMFEDY-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=C(C(OC)=O)C=C1 |
| CAS DataBase Reference | 881-86-7(CAS DataBase Reference) |
Description and Uses
It is the intermediate in the synthesis of potent antitumor agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






