A3822312
4,6-Dimethyl-2-methylmercapyrimidine , 98% , 14001-64-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB99.20 | In Stock |
|
| 25G | RMB350.40 | In Stock |
|
| 100G | RMB1257.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24 °C |
| Boiling point: | 120-122 °C(Press: 17 Torr) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Brown to Dark Brown Semi-Solid |
| pka | 2.38±0.30(Predicted) |
| InChI | InChI=1S/C7H10N2S/c1-5-4-6(2)9-7(8-5)10-3/h4H,1-3H3 |
| InChIKey | LMTOWNMJYBIWTI-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC(C)=CC(C)=N1 |
| CAS DataBase Reference | 14001-64-0(CAS DataBase Reference) |
Description and Uses
4,6-Dimethyl-2-(methylthio)pyrimidine is a useful reactant for the synthesis of substituted heterocycles via nickel-catalyzed cross-coupling reaction.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H228 |
| Precautionary statements | P280-P370+P378r-P403-P501c |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 29339900 |
