A3824812
D(-)-Phenylglycinamide , 98% , 6485-67-2
CAS NO.:6485-67-2
Empirical Formula: C8H10N2O
Molecular Weight: 150.18
MDL number: MFCD06799064
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB212.00 | In Stock |
|
| 100G | RMB702.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-129 °C |
| alpha | -48.5 º (c=0.55, EtOH) |
| Boiling point: | 271.72°C (rough estimate) |
| Density | 1.1392 (rough estimate) |
| refractive index | 1.6180 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Aqueous Acid (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) |
| pka | 15.61±0.50(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| InChI | InChI=1/C8H10N2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H2,10,11)/t7-/s3 |
| InChIKey | KIYRSYYOVDHSPG-KPOCXSGKNA-N |
| SMILES | C(N)(=O)[C@H](N)C1C=CC=CC=1 |&1:3,r| |
| CAS DataBase Reference | 6485-67-2(CAS DataBase Reference) |
Description and Uses
D-Phenylglycinamide is used in the synthesis of Boceprevir (B674500),an inhibitor of hepatitis C.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P271-P261-P280 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | WGK 3 |
| HS Code | 29242998 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





