M3621435
MethylD-(-)-4-hydroxy-phenylglycinate , 98% , 37763-23-8
CAS NO.：37763-23-8
Empirical Formula: C9H11NO3
Molecular Weight: 181.19
MDL number: MFCD09038793
EINECS: 253-657-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB54.40 | In Stock |
|
| 25g | RMB142.40 | In Stock |
|
| 100g | RMB456.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-172°C |
| Boiling point: | 303.2±27.0 °C(Predicted) |
| Density | 1.248±0.06 g/cm3(Predicted) |
| vapor pressure | 0.083Pa at 25℃ |
| storage temp. | Room Temperature |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| pka | 9.74±0.26(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C9H11NO3/c1-13-9(12)8(10)6-2-4-7(11)5-3-6/h2-5,8,11H,10H2,1H3 |
| InChIKey | SZBDOFWNZVHVGR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(N)C1=CC=C(O)C=C1 |
Description and Uses
Methyl D-(-)-4-Hydroxy-phenylglycinate is useful for the synthesis (+)-radicamine B. Also, it is used for the preparation of amoxicillin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
