A3888312
Diethylphenylphosphine , ≥85% , 1605-53-4
Synonym(s):
NSC 158475
CAS NO.:1605-53-4
Empirical Formula: C10H15P
Molecular Weight: 166.2
MDL number: MFCD00015172
EINECS: 216-516-6
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB231.20 | In Stock |
|
| 5ML | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45 °C |
| Boiling point: | 120-121 °C/29 mmHg (lit.) |
| Density | 0.954 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| form | Liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.954 |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air & Moisture Sensitive |
| BRN | 742484 |
| InChI | InChI=1S/C10H15P/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | LVTCZSBUROAWTE-UHFFFAOYSA-N |
| SMILES | P(CC)(CC)C1=CC=CC=C1 |
| CAS DataBase Reference | 1605-53-4(CAS DataBase Reference) |
Description and Uses
Diethylphenylphosphine is used as a catalyst for selective cross-dimerization, carboxyl migration reactions, selective hydrogenation, asymmetric induction by chiral diphosphines in ring contraction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 17-26-36 |
| RIDADR | UN3278 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







