LN9050846
Di-tert-butylphenylphosphine , 97% , 32673-25-9
Synonym(s):
NSC 244300
| Pack Size | Price | Stock | Quantity |
| 1g | RMB237.60 | In Stock |
|
| 5g | RMB899.20 | In Stock |
|
| 25g | RMB3575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 124-128 °C/10 mmHg |
| Density | 0.933 g/mL at 25 °C |
| refractive index | n20/D 1.5382 |
| form | liquid |
| color | colorless |
| Sensitive | air sensitive |
| λmax | 260nm(Cyclohexane)(lit.) |
| InChI | InChI=1S/C14H23P/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3 |
| InChIKey | XOJNEFQLMRCOMS-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(C(C)(C)C)C(C)(C)C |
Description and Uses
Di-tert-butylphenylphosphine is used as a catalyst in the cross-coupling of secondary organotrifluoroborates with aryl chlorides and bromides.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H250-H315-H319-H335-H413 |
| Precautionary statements | P231+P232-P273-P280-P302+P352-P305+P351+P338-P370+P378 |
| Hazard Codes | F,Xi |
| Risk Statements | 17-36/37/38 |
| Safety Statements | 6-26 |
| RIDADR | UN 2845 4.2/PG 1 |
| WGK Germany | 3 |
| HazardClass | 4.2 |
| HS Code | 2931499090 |
